C9H18N2 — CID 67207240
(4R)-spiro[4.4]nonane-4,9-diamine (PubChem CID 67207240) has the molecular formula C9H18N2 and a molecular weight of 154.26 g/mol. Its IUPAC name is (4R)-spiro[4.4]nonane-4,9-diamine.
| Compound Name | (4R)-spiro[4.4]nonane-4,9-diamine |
|---|---|
| PubChem CID | 67207240 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (4R)-spiro[4.4]nonane-4,9-diamine |
| SMILES | NC1CCCC12CCC[C@H]2N |
| InChI | InChI=1S/C9H18N2/c10-7-3-1-5-9(7)6-2-4-8(9)11/h7-8H,1-6,10-11H2/t7-,8?,9?/m1/s1 |
| InChIKey | BNILUWOCEPQBHS-AFPNSQJFSA-N |
| XLogP | 1.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |