About (4R)-spiro[4.4]nonane-4,9-diamine
(4R)-spiro[4.4]nonane-4,9-diamine (PubChem CID 67207240) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is (4R)-spiro[4.4]nonane-4,9-diamine.
Molecular Properties
| Compound Name | (4R)-spiro[4.4]nonane-4,9-diamine |
| PubChem CID | 67207240 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | (4R)-spiro[4.4]nonane-4,9-diamine |
| SMILES | NC1CCCC12CCC[C@H]2N |
| InChI | InChI=1S/C9H18N2/c10-7-3-1-5-9(7)6-2-4-8(9)11/h7-8H,1-6,10-11H2/t7-,8?,9?/m1/s1 |
| InChIKey | BNILUWOCEPQBHS-AFPNSQJFSA-N |
| XLogP | 1.00 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4R)-spiro[4.4]nonane-4,9-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-spiro[4.4]nonane-4,9-diamine?
The IUPAC name of (4R)-spiro[4.4]nonane-4,9-diamine (CID 67207240) is (4R)-spiro[4.4]nonane-4,9-diamine.
What is the SMILES notation for (4R)-spiro[4.4]nonane-4,9-diamine?
The canonical SMILES for (4R)-spiro[4.4]nonane-4,9-diamine is NC1CCCC12CCC[C@H]2N.
What is the InChIKey of (4R)-spiro[4.4]nonane-4,9-diamine?
The InChIKey is BNILUWOCEPQBHS-AFPNSQJFSA-N. The full InChI is InChI=1S/C9H18N2/c10-7-3-1-5-9(7)6-2-4-8(9)11/h7-8H,1-6,10-11H2/t7-,8?,9?/m1/s1.
What are the key properties of (4R)-spiro[4.4]nonane-4,9-diamine?
(4R)-spiro[4.4]nonane-4,9-diamine has a molecular weight of 154.26 g/mol, XLogP of 1.00, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-spiro[4.4]nonane-4,9-diamine is sourced from PubChem (CID 67207240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).