C12H20Cl2N2O4Pt — CID 71498793
dichloroplatinum(2+);propanedioate;(4S,9S)-spiro[4.4]nonane-4,9-diamine (PubChem CID 71498793) has the molecular formula C12H20Cl2N2O4Pt and a molecular weight of 522.29 g/mol. Its IUPAC name is dichloroplatinum(2+);propanedioate;(4S,9S)-spiro[4.4]nonane-4,9-diamine.
| Compound Name | dichloroplatinum(2+);propanedioate;(4S,9S)-spiro[4.4]nonane-4,9-diamine |
|---|---|
| PubChem CID | 71498793 |
| Molecular Formula | C12H20Cl2N2O4Pt |
| Molecular Weight | 522.29 g/mol |
| Exact Mass | 521.04 |
| IUPAC Name | dichloroplatinum(2+);propanedioate;(4S,9S)-spiro[4.4]nonane-4,9-diamine |
| SMILES | Cl[Pt+2]Cl.N[C@H]1CCCC12CCC[C@@H]2N.O=C([O-])CC(=O)[O-] |
| InChI | InChI=1S/C9H18N2.C3H4O4.2ClH.Pt/c10-7-3-1-5-9(7)6-2-4-8(9)11;4-2(5)1-3(6)7;;;/h7-8H,1-6,10-11H2;1H2,(H,4,5)(H,6,7);2*1H;/q;;;;+4/p-4/t7-,8-,9?;;;;/m0..../s1 |
| InChIKey | ILKBTRZQXOLTOE-SVCWMKRVSA-J |
| XLogP | -0.75 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.29 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|