C23H20ClNO6 — CID 67208755
3-[[5-(carboxymethyl)furan-2-carbonyl]amino]-4-[4-(3-chlorophenyl)phenyl]butanoic acid (PubChem CID 67208755) has the molecular formula C23H20ClNO6 and a molecular weight of 441.87 g/mol. Its IUPAC name is 3-[[5-(carboxymethyl)furan-2-carbonyl]amino]-4-[4-(3-chlorophenyl)phenyl]butanoic acid.
| Compound Name | 3-[[5-(carboxymethyl)furan-2-carbonyl]amino]-4-[4-(3-chlorophenyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 67208755 |
| Molecular Formula | C23H20ClNO6 |
| Molecular Weight | 441.87 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | 3-[[5-(carboxymethyl)furan-2-carbonyl]amino]-4-[4-(3-chlorophenyl)phenyl]butanoic acid |
| SMILES | O=C(O)Cc1ccc(C(=O)NC(CC(=O)O)Cc2ccc(-c3cccc(Cl)c3)cc2)o1 |
| InChI | InChI=1S/C23H20ClNO6/c24-17-3-1-2-16(11-17)15-6-4-14(5-7-15)10-18(12-21(26)27)25-23(30)20-9-8-19(31-20)13-22(28)29/h1-9,11,18H,10,12-13H2,(H,25,30)(H,26,27)(H,28,29) |
| InChIKey | XMTDGBQWERKGDE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |