C17H21NO6 — CID 67212181
1-[(4-methoxyphenyl)methyl]-3,5-dimethyl-4-oxopiperidine-2,2-dicarboxylic acid (PubChem CID 67212181) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3,5-dimethyl-4-oxopiperidine-2,2-dicarboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3,5-dimethyl-4-oxopiperidine-2,2-dicarboxylic acid |
|---|---|
| PubChem CID | 67212181 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3,5-dimethyl-4-oxopiperidine-2,2-dicarboxylic acid |
| SMILES | COc1ccc(CN2CC(C)C(=O)C(C)C2(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C17H21NO6/c1-10-8-18(9-12-4-6-13(24-3)7-5-12)17(15(20)21,16(22)23)11(2)14(10)19/h4-7,10-11H,8-9H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | WIKSZTQHEYAYFM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|