C24H24N2O3S — CID 67212217
[3-benzyl-2-(thiophen-2-ylmethyl)indazol-6-yl] tert-butyl carbonate (PubChem CID 67212217) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is [3-benzyl-2-(thiophen-2-ylmethyl)indazol-6-yl] tert-butyl carbonate.
| Compound Name | [3-benzyl-2-(thiophen-2-ylmethyl)indazol-6-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 67212217 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [3-benzyl-2-(thiophen-2-ylmethyl)indazol-6-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc2c(Cc3ccccc3)n(Cc3cccs3)nc2c1 |
| InChI | InChI=1S/C24H24N2O3S/c1-24(2,3)29-23(27)28-18-11-12-20-21(15-18)25-26(16-19-10-7-13-30-19)22(20)14-17-8-5-4-6-9-17/h4-13,15H,14,16H2,1-3H3 |
| InChIKey | YAUUFVNOQCCSTM-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|