C20H18N4O4 — CID 67213224
5-carbamoyl-4-[4-[(3-methylphenyl)carbamoylamino]phenyl]-1H-pyrrole-3-carboxylic acid (PubChem CID 67213224) has the molecular formula C20H18N4O4 and a molecular weight of 378.39 g/mol. Its IUPAC name is 5-carbamoyl-4-[4-[(3-methylphenyl)carbamoylamino]phenyl]-1H-pyrrole-3-carboxylic acid.
| Compound Name | 5-carbamoyl-4-[4-[(3-methylphenyl)carbamoylamino]phenyl]-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 67213224 |
| Molecular Formula | C20H18N4O4 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 5-carbamoyl-4-[4-[(3-methylphenyl)carbamoylamino]phenyl]-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1cccc(NC(=O)Nc2ccc(-c3c(C(=O)O)c[nH]c3C(N)=O)cc2)c1 |
| InChI | InChI=1S/C20H18N4O4/c1-11-3-2-4-14(9-11)24-20(28)23-13-7-5-12(6-8-13)16-15(19(26)27)10-22-17(16)18(21)25/h2-10,22H,1H3,(H2,21,25)(H,26,27)(H2,23,24,28) |
| InChIKey | GIZONOUOKFUFHA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 137.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |