C20H26FN3 — CID 67214444
1-cyclohexyl-N-(cyclopropylmethyl)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]methanamine (PubChem CID 67214444) has the molecular formula C20H26FN3 and a molecular weight of 327.45 g/mol. Its IUPAC name is 1-cyclohexyl-N-(cyclopropylmethyl)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]methanamine.
| Compound Name | 1-cyclohexyl-N-(cyclopropylmethyl)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]methanamine |
|---|---|
| PubChem CID | 67214444 |
| Molecular Formula | C20H26FN3 |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-cyclohexyl-N-(cyclopropylmethyl)-1-[5-(4-fluorophenyl)-1H-imidazol-2-yl]methanamine |
| SMILES | Fc1ccc(-c2cnc(C(NCC3CC3)C3CCCCC3)[nH]2)cc1 |
| InChI | InChI=1S/C20H26FN3/c21-17-10-8-15(9-11-17)18-13-23-20(24-18)19(22-12-14-6-7-14)16-4-2-1-3-5-16/h8-11,13-14,16,19,22H,1-7,12H2,(H,23,24) |
| InChIKey | JYBWBVUBFXDDGD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |