C20H30O11 — CID 67215206
(2R,3R,4S,5S,6R)-2-(1-phenylethyl)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol (PubChem CID 67215206) has the molecular formula C20H30O11 and a molecular weight of 446.45 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-(1-phenylethyl)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol.
| Compound Name | (2R,3R,4S,5S,6R)-2-(1-phenylethyl)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 67215206 |
| Molecular Formula | C20H30O11 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-(1-phenylethyl)-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxane-2,3,4,5-tetrol |
| SMILES | CC(c1ccccc1)[C@@]1(O)O[C@H](CO[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H30O11/c1-9(10-5-3-2-4-6-10)20(28)18(27)16(25)14(23)12(31-20)8-29-19-17(26)15(24)13(22)11(7-21)30-19/h2-6,9,11-19,21-28H,7-8H2,1H3/t9?,11-,12-,13-,14-,15+,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | XEWAGLPDOKVPOC-XVDVXUHISA-N |
| XLogP | -3.22 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |