C26H19ClN4O2S2 — CID 67216327
2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(3-hydroxypropoxy)-4-phenylpyridine-3,5-dicarbonitrile (PubChem CID 67216327) has the molecular formula C26H19ClN4O2S2 and a molecular weight of 519.05 g/mol. Its IUPAC name is 2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(3-hydroxypropoxy)-4-phenylpyridine-3,5-dicarbonitrile.
| Compound Name | 2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(3-hydroxypropoxy)-4-phenylpyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 67216327 |
| Molecular Formula | C26H19ClN4O2S2 |
| Molecular Weight | 519.05 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | 2-[[2-(4-chlorophenyl)-1,3-thiazol-4-yl]methylsulfanyl]-6-(3-hydroxypropoxy)-4-phenylpyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(OCCCO)nc(SCc2csc(-c3ccc(Cl)cc3)n2)c(C#N)c1-c1ccccc1 |
| InChI | InChI=1S/C26H19ClN4O2S2/c27-19-9-7-18(8-10-19)25-30-20(15-34-25)16-35-26-22(14-29)23(17-5-2-1-3-6-17)21(13-28)24(31-26)33-12-4-11-32/h1-3,5-10,15,32H,4,11-12,16H2 |
| InChIKey | GRSLTHGPDHFHAK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.05 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|