C28H36N5O5P — CID 67216851
[3-[11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]-2,2,4,4-tetramethylpentan-3-yl] dihydrogen phosphate (PubChem CID 67216851) has the molecular formula C28H36N5O5P and a molecular weight of 553.60 g/mol. Its IUPAC name is [3-[11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]-2,2,4,4-tetramethylpentan-3-yl] dihydrogen phosphate.
| Compound Name | [3-[11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]-2,2,4,4-tetramethylpentan-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 67216851 |
| Molecular Formula | C28H36N5O5P |
| Molecular Weight | 553.60 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | [3-[11-(5-methoxy-1-methylindol-3-yl)-3-methyl-3,4,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-10-yl]-2,2,4,4-tetramethylpentan-3-yl] dihydrogen phosphate |
| SMILES | COc1ccc2c(c1)c(-c1cc3c4c(cnc3n1C(OP(=O)(O)O)(C(C)(C)C)C(C)(C)C)cnn4C)cn2C |
| InChI | InChI=1S/C28H36N5O5P/c1-26(2,3)28(27(4,5)6,38-39(34,35)36)33-23(13-20-24-17(14-29-25(20)33)15-30-32(24)8)21-16-31(7)22-11-10-18(37-9)12-19(21)22/h10-16H,1-9H3,(H2,34,35,36) |
| InChIKey | GPEJCJVSHCFHON-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.60 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|