C22H16BrN3O — CID 67217048
(E)-N-benzhydryl-3-(3-bromo-2-pyridinyl)-2-cyanoprop-2-enamide (PubChem CID 67217048) has the molecular formula C22H16BrN3O and a molecular weight of 418.29 g/mol. Its IUPAC name is (E)-N-benzhydryl-3-(3-bromo-2-pyridinyl)-2-cyanoprop-2-enamide.
| Compound Name | (E)-N-benzhydryl-3-(3-bromo-2-pyridinyl)-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 67217048 |
| Molecular Formula | C22H16BrN3O |
| Molecular Weight | 418.29 g/mol |
| Exact Mass | 417.05 |
| IUPAC Name | (E)-N-benzhydryl-3-(3-bromo-2-pyridinyl)-2-cyanoprop-2-enamide |
| SMILES | N#C/C(=C\c1ncccc1Br)C(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H16BrN3O/c23-19-12-7-13-25-20(19)14-18(15-24)22(27)26-21(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-14,21H,(H,26,27)/b18-14+ |
| InChIKey | WRGOVBLBHLKDPZ-NBVRZTHBSA-N |
| XLogP | 4.66 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|