C19H23Cl3N2O5 — CID 67217514
(E)-but-2-enedioic acid;N-ethyl-2-piperidin-4-yl-N-(2,3,4-trichlorophenyl)acetamide (PubChem CID 67217514) has the molecular formula C19H23Cl3N2O5 and a molecular weight of 465.76 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;N-ethyl-2-piperidin-4-yl-N-(2,3,4-trichlorophenyl)acetamide.
| Compound Name | (E)-but-2-enedioic acid;N-ethyl-2-piperidin-4-yl-N-(2,3,4-trichlorophenyl)acetamide |
|---|---|
| PubChem CID | 67217514 |
| Molecular Formula | C19H23Cl3N2O5 |
| Molecular Weight | 465.76 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | (E)-but-2-enedioic acid;N-ethyl-2-piperidin-4-yl-N-(2,3,4-trichlorophenyl)acetamide |
| SMILES | CCN(C(=O)CC1CCNCC1)c1ccc(Cl)c(Cl)c1Cl.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C15H19Cl3N2O.C4H4O4/c1-2-20(12-4-3-11(16)14(17)15(12)18)13(21)9-10-5-7-19-8-6-10;5-3(6)1-2-4(7)8/h3-4,10,19H,2,5-9H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | DEGCFKWSEBSODB-WLHGVMLRSA-N |
| XLogP | 4.10 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.76 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|