C17H12Cl2N4O — CID 67218717
6-(3,4-dichlorophenyl)-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide (PubChem CID 67218717) has the molecular formula C17H12Cl2N4O and a molecular weight of 359.22 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide.
| Compound Name | 6-(3,4-dichlorophenyl)-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 67218717 |
| Molecular Formula | C17H12Cl2N4O |
| Molecular Weight | 359.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-N-(pyridin-4-ylmethyl)pyrimidine-4-carboxamide |
| SMILES | O=C(NCc1ccncc1)c1cc(-c2ccc(Cl)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C17H12Cl2N4O/c18-13-2-1-12(7-14(13)19)15-8-16(23-10-22-15)17(24)21-9-11-3-5-20-6-4-11/h1-8,10H,9H2,(H,21,24) |
| InChIKey | GGGGTPFXIUGIDD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.22 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |