C13H12N4O4 — CID 69159261
methyl [6-(pyridin-4-ylmethylcarbamoyl)pyrimidin-4-yl] carbonate (PubChem CID 69159261) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is methyl [6-(pyridin-4-ylmethylcarbamoyl)pyrimidin-4-yl] carbonate.
| Compound Name | methyl [6-(pyridin-4-ylmethylcarbamoyl)pyrimidin-4-yl] carbonate |
|---|---|
| PubChem CID | 69159261 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl [6-(pyridin-4-ylmethylcarbamoyl)pyrimidin-4-yl] carbonate |
| SMILES | COC(=O)Oc1cc(C(=O)NCc2ccncc2)ncn1 |
| InChI | InChI=1S/C13H12N4O4/c1-20-13(19)21-11-6-10(16-8-17-11)12(18)15-7-9-2-4-14-5-3-9/h2-6,8H,7H2,1H3,(H,15,18) |
| InChIKey | CNZKXJMVMDPIDK-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |