C23H29N6OS+ — CID 67220859
(3R)-5'-[5-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)thiophen-2-yl]spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine] (PubChem CID 67220859) has the molecular formula C23H29N6OS+ and a molecular weight of 437.59 g/mol. Its IUPAC name is (3R)-5'-[5-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)thiophen-2-yl]spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine].
| Compound Name | (3R)-5'-[5-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)thiophen-2-yl]spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine] |
|---|---|
| PubChem CID | 67220859 |
| Molecular Formula | C23H29N6OS+ |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | (3R)-5'-[5-(3,5,7-triaza-1-azoniatricyclo[3.3.1.13,7]decan-1-yl)thiophen-2-yl]spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine] |
| SMILES | c1nc2c(cc1-c1ccc([N+]34CN5CN(CN(C5)C3)C4)s1)C[C@@]1(CN3CCC1CC3)O2 |
| InChI | InChI=1S/C23H29N6OS/c1-2-21(29-14-26-11-27(15-29)13-28(12-26)16-29)31-20(1)18-7-17-8-23(30-22(17)24-9-18)10-25-5-3-19(23)4-6-25/h1-2,7,9,19H,3-6,8,10-16H2/q+1/t23-/m0/s1 |
| InChIKey | AUVPHMMIKQFDGM-QHCPKHFHSA-N |
| XLogP | 2.21 |
| TPSA | 35.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|