C18H18N2O3 — CID 59560532
5-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]furan-2-carbaldehyde (PubChem CID 59560532) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 5-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]furan-2-carbaldehyde.
| Compound Name | 5-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 59560532 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 5-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]furan-2-carbaldehyde |
| SMILES | O=Cc1ccc(-c2cnc3c(c2)C[C@@]2(CN4CCC2CC4)O3)o1 |
| InChI | InChI=1S/C18H18N2O3/c21-10-15-1-2-16(22-15)13-7-12-8-18(23-17(12)19-9-13)11-20-5-3-14(18)4-6-20/h1-2,7,9-10,14H,3-6,8,11H2/t18-/m0/s1 |
| InChIKey | MTYAATUIDGUCHU-SFHVURJKSA-N |
| XLogP | 2.55 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|