C22H23N3O — CID 23595086
(3R)-N-(3-phenylprop-1-ynyl)spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-amine (PubChem CID 23595086) has the molecular formula C22H23N3O and a molecular weight of 345.45 g/mol. Its IUPAC name is (3R)-N-(3-phenylprop-1-ynyl)spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-amine.
| Compound Name | (3R)-N-(3-phenylprop-1-ynyl)spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-amine |
|---|---|
| PubChem CID | 23595086 |
| Molecular Formula | C22H23N3O |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | (3R)-N-(3-phenylprop-1-ynyl)spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-amine |
| SMILES | C(#CNc1cnc2c(c1)C[C@@]1(CN3CCC1CC3)O2)Cc1ccccc1 |
| InChI | InChI=1S/C22H23N3O/c1-2-5-17(6-3-1)7-4-10-23-20-13-18-14-22(26-21(18)24-15-20)16-25-11-8-19(22)9-12-25/h1-3,5-6,13,15,19,23H,7-9,11-12,14,16H2/t22-/m0/s1 |
| InChIKey | UTTAWJTWNILILN-QFIPXVFZSA-N |
| XLogP | 3.10 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|