C27H28N4O6 — CID 67223120
(5R)-3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-[[2-[(9R)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]ethylamino]methyl]-1,3-oxazolidin-2-one (PubChem CID 67223120) has the molecular formula C27H28N4O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is (5R)-3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-[[2-[(9R)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]ethylamino]methyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-[[2-[(9R)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]ethylamino]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67223120 |
| Molecular Formula | C27H28N4O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (5R)-3-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)-5-[[2-[(9R)-2-methoxy-8,9-dihydrofuro[2,3-c][1,5]naphthyridin-9-yl]ethylamino]methyl]-1,3-oxazolidin-2-one |
| SMILES | COc1ccc2ncc3c(c2n1)[C@@H](CCNC[C@@H]1CN(C2=COC=C(C4=CC=CCC4)O2)C(=O)O1)CO3 |
| InChI | InChI=1S/C27H28N4O6/c1-33-23-8-7-20-26(30-23)25-18(14-35-21(25)12-29-20)9-10-28-11-19-13-31(27(32)36-19)24-16-34-15-22(37-24)17-5-3-2-4-6-17/h2-3,5,7-8,12,15-16,18-19,28H,4,6,9-11,13-14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | PCWDXGNVSRUJDU-RBUKOAKNSA-N |
| XLogP | 3.88 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|