C21H23NO6 — CID 67223561
(2R)-2-hydroxy-2-[(2R)-3-oxo-4-[3-(2-phenylmethoxyethyl)phenyl]morpholin-2-yl]acetic acid (PubChem CID 67223561) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is (2R)-2-hydroxy-2-[(2R)-3-oxo-4-[3-(2-phenylmethoxyethyl)phenyl]morpholin-2-yl]acetic acid.
| Compound Name | (2R)-2-hydroxy-2-[(2R)-3-oxo-4-[3-(2-phenylmethoxyethyl)phenyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 67223561 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | (2R)-2-hydroxy-2-[(2R)-3-oxo-4-[3-(2-phenylmethoxyethyl)phenyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)[C@H](O)[C@H]1OCCN(c2cccc(CCOCc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C21H23NO6/c23-18(21(25)26)19-20(24)22(10-12-28-19)17-8-4-7-15(13-17)9-11-27-14-16-5-2-1-3-6-16/h1-8,13,18-19,23H,9-12,14H2,(H,25,26)/t18-,19-/m1/s1 |
| InChIKey | LDFQIISIPVOMKR-RTBURBONSA-N |
| XLogP | 1.62 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|