C23H27NO6 — CID 58290450
tert-butyl (2R)-2-hydroxy-2-[(2R)-3-oxo-4-(3-phenylmethoxyphenyl)morpholin-2-yl]acetate (PubChem CID 58290450) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is tert-butyl (2R)-2-hydroxy-2-[(2R)-3-oxo-4-(3-phenylmethoxyphenyl)morpholin-2-yl]acetate.
| Compound Name | tert-butyl (2R)-2-hydroxy-2-[(2R)-3-oxo-4-(3-phenylmethoxyphenyl)morpholin-2-yl]acetate |
|---|---|
| PubChem CID | 58290450 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | tert-butyl (2R)-2-hydroxy-2-[(2R)-3-oxo-4-(3-phenylmethoxyphenyl)morpholin-2-yl]acetate |
| SMILES | CC(C)(C)OC(=O)[C@H](O)[C@H]1OCCN(c2cccc(OCc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C23H27NO6/c1-23(2,3)30-22(27)19(25)20-21(26)24(12-13-28-20)17-10-7-11-18(14-17)29-15-16-8-5-4-6-9-16/h4-11,14,19-20,25H,12-13,15H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | QPGNXIKJSKMZDZ-WOJBJXKFSA-N |
| XLogP | 2.70 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |