C21H28FNO7 — CID 76743059
tert-butyl 2-[4-[4-fluoro-3-(oxan-4-yloxy)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetate (PubChem CID 76743059) has the molecular formula C21H28FNO7 and a molecular weight of 425.45 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-fluoro-3-(oxan-4-yloxy)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetate.
| Compound Name | tert-butyl 2-[4-[4-fluoro-3-(oxan-4-yloxy)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 76743059 |
| Molecular Formula | C21H28FNO7 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | tert-butyl 2-[4-[4-fluoro-3-(oxan-4-yloxy)phenyl]-3-oxomorpholin-2-yl]-2-hydroxyacetate |
| SMILES | CC(C)(C)OC(=O)C(O)C1OCCN(c2ccc(F)c(OC3CCOCC3)c2)C1=O |
| InChI | InChI=1S/C21H28FNO7/c1-21(2,3)30-20(26)17(24)18-19(25)23(8-11-28-18)13-4-5-15(22)16(12-13)29-14-6-9-27-10-7-14/h4-5,12,14,17-18,24H,6-11H2,1-3H3 |
| InChIKey | MCXZFCWQTZHWGR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |