About 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol
2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol (PubChem CID 67225679) has the molecular formula C25H36O
and a molecular weight of 352.56 g/mol. Its IUPAC name is 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol.
Molecular Properties
| Compound Name | 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol |
| PubChem CID | 67225679 |
| Molecular Formula | C25H36O |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.28 |
| IUPAC Name | 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol |
| SMILES | CCCc1ccc(C(C)(C)Cc2ccccc2O)c(CCC)c1CCC |
| InChI | InChI=1S/C25H36O/c1-6-11-19-16-17-23(22(13-8-3)21(19)12-7-2)25(4,5)18-20-14-9-10-15-24(20)26/h9-10,14-17,26H,6-8,11-13,18H2,1-5H3 |
| InChIKey | CKNNDYBRVMKFOT-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol?
The IUPAC name of 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol (CID 67225679) is 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol.
What is the SMILES notation for 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol?
The canonical SMILES for 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol is CCCc1ccc(C(C)(C)Cc2ccccc2O)c(CCC)c1CCC.
What is the InChIKey of 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol?
The InChIKey is CKNNDYBRVMKFOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H36O/c1-6-11-19-16-17-23(22(13-8-3)21(19)12-7-2)25(4,5)18-20-14-9-10-15-24(20)26/h9-10,14-17,26H,6-8,11-13,18H2,1-5H3.
What are the key properties of 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol?
2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol has a molecular weight of 352.56 g/mol, XLogP of 6.77, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-methyl-2-(2,3,4-tripropylphenyl)propyl]phenol is sourced from PubChem (CID 67225679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).