C24H28N4O5 — CID 67226873
5-(2,2-dimethylpropyl)-N-(2-methoxy-4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 67226873) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 5-(2,2-dimethylpropyl)-N-(2-methoxy-4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | 5-(2,2-dimethylpropyl)-N-(2-methoxy-4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 67226873 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 5-(2,2-dimethylpropyl)-N-(2-methoxy-4-nitrophenyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C1CC2(CN1)C(=O)Nc1ccc(CC(C)(C)C)cc12 |
| InChI | InChI=1S/C24H28N4O5/c1-23(2,3)11-14-5-7-17-16(9-14)24(22(30)27-17)12-19(25-13-24)21(29)26-18-8-6-15(28(31)32)10-20(18)33-4/h5-10,19,25H,11-13H2,1-4H3,(H,26,29)(H,27,30) |
| InChIKey | PEWPXZFVHUWWIL-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|