C23H25N3O6 — CID 6722855
N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]-7-methoxy-1-benzofuran-2-carboxamide (PubChem CID 6722855) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]-7-methoxy-1-benzofuran-2-carboxamide.
| Compound Name | N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]-7-methoxy-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 6722855 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]-7-methoxy-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc2cc(C(=O)N[C@@H](CO)C(=O)Nc3ccc(N4CCOCC4)cc3)oc12 |
| InChI | InChI=1S/C23H25N3O6/c1-30-19-4-2-3-15-13-20(32-21(15)19)23(29)25-18(14-27)22(28)24-16-5-7-17(8-6-16)26-9-11-31-12-10-26/h2-8,13,18,27H,9-12,14H2,1H3,(H,24,28)(H,25,29)/t18-/m0/s1 |
| InChIKey | LLXLBRNMONVWKL-SFHVURJKSA-N |
| XLogP | 2.01 |
| TPSA | 113.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|