C18H21N3O4S — CID 6724682
N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 6724682) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 6724682 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | N-[(2S)-3-hydroxy-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H](CO)C(=O)Nc1ccc(N2CCOCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C18H21N3O4S/c22-12-15(20-18(24)16-2-1-11-26-16)17(23)19-13-3-5-14(6-4-13)21-7-9-25-10-8-21/h1-6,11,15,22H,7-10,12H2,(H,19,23)(H,20,24)/t15-/m0/s1 |
| InChIKey | DEZUDWQCGOPTMA-HNNXBMFYSA-N |
| XLogP | 1.31 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|