C13H10N2O2S — CID 672289
2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid (PubChem CID 672289) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid.
| Compound Name | 2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid |
|---|---|
| PubChem CID | 672289 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid |
| SMILES | O=C(O)Cc1csc2nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C13H10N2O2S/c16-12(17)6-10-8-18-13-14-11(7-15(10)13)9-4-2-1-3-5-9/h1-5,7-8H,6H2,(H,16,17) |
| InChIKey | ZBDXJNSQBIUHPE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |