About tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide
tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide (PubChem CID 67235308) has the molecular formula C13H26BrN3O2
and a molecular weight of 336.27 g/mol. Its IUPAC name is tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide.
Molecular Properties
| Compound Name | tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide |
| PubChem CID | 67235308 |
| Molecular Formula | C13H26BrN3O2 |
| Molecular Weight | 336.27 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide |
| SMILES | CC(C)(C)OC(=O)NCC[N+]12CCN(CC1)CC2.[Br-] |
| InChI | InChI=1S/C13H25N3O2.BrH/c1-13(2,3)18-12(17)14-4-8-16-9-5-15(6-10-16)7-11-16;/h4-11H2,1-3H3;1H |
| InChIKey | IIFOOQDVISDHFN-UHFFFAOYSA-N |
| XLogP | -2.34 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.27 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide?
The IUPAC name of tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide (CID 67235308) is tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide.
What is the SMILES notation for tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide?
The canonical SMILES for tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide is CC(C)(C)OC(=O)NCC[N+]12CCN(CC1)CC2.[Br-].
What is the InChIKey of tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide?
The InChIKey is IIFOOQDVISDHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N3O2.BrH/c1-13(2,3)18-12(17)14-4-8-16-9-5-15(6-10-16)7-11-16;/h4-11H2,1-3H3;1H.
What are the key properties of tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide?
tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide has a molecular weight of 336.27 g/mol, XLogP of -2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(4-aza-1-azoniabicyclo[2.2.2]octan-1-yl)ethyl]carbamate bromide is sourced from PubChem (CID 67235308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).