C10H14O5 — CID 67235684
ethyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)-2-oxopropanoate (PubChem CID 67235684) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is ethyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)-2-oxopropanoate.
| Compound Name | ethyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)-2-oxopropanoate |
|---|---|
| PubChem CID | 67235684 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | ethyl (3E)-3-(2,2-dimethyl-1,3-dioxolan-4-ylidene)-2-oxopropanoate |
| SMILES | CCOC(=O)C(=O)/C=C1\COC(C)(C)O1 |
| InChI | InChI=1S/C10H14O5/c1-4-13-9(12)8(11)5-7-6-14-10(2,3)15-7/h5H,4,6H2,1-3H3/b7-5+ |
| InChIKey | NSTRXMLJJLAOEL-FNORWQNLSA-N |
| XLogP | 0.79 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|