C8H12F2N2O4 — CID 67238174
[(1R,2R)-2-(carboxyamino)-3,3-difluorocyclohexyl]carbamic acid (PubChem CID 67238174) has the molecular formula C8H12F2N2O4 and a molecular weight of 238.19 g/mol. Its IUPAC name is [(1R,2R)-2-(carboxyamino)-3,3-difluorocyclohexyl]carbamic acid.
| Compound Name | [(1R,2R)-2-(carboxyamino)-3,3-difluorocyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 67238174 |
| Molecular Formula | C8H12F2N2O4 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [(1R,2R)-2-(carboxyamino)-3,3-difluorocyclohexyl]carbamic acid |
| SMILES | O=C(O)N[C@@H]1[C@H](NC(=O)O)CCCC1(F)F |
| InChI | InChI=1S/C8H12F2N2O4/c9-8(10)3-1-2-4(11-6(13)14)5(8)12-7(15)16/h4-5,11-12H,1-3H2,(H,13,14)(H,15,16)/t4-,5-/m1/s1 |
| InChIKey | KHKNUXLCTZGSPK-RFZPGFLSSA-N |
| XLogP | 1.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |