C19H30N2O2 — CID 67241240
(1-benzyl-4-methylpiperidin-3-yl)methyl-tert-butylcarbamic acid (PubChem CID 67241240) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1-benzyl-4-methylpiperidin-3-yl)methyl-tert-butylcarbamic acid.
| Compound Name | (1-benzyl-4-methylpiperidin-3-yl)methyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67241240 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (1-benzyl-4-methylpiperidin-3-yl)methyl-tert-butylcarbamic acid |
| SMILES | CC1CCN(Cc2ccccc2)CC1CN(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H30N2O2/c1-15-10-11-20(12-16-8-6-5-7-9-16)13-17(15)14-21(18(22)23)19(2,3)4/h5-9,15,17H,10-14H2,1-4H3,(H,22,23) |
| InChIKey | RXNVHIZGTLQDME-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |