C21H24N2O2 — CID 67242056
2,3-dihydro-1H-inden-2-yl-(4-piperidin-3-ylphenyl)carbamic acid (PubChem CID 67242056) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-2-yl-(4-piperidin-3-ylphenyl)carbamic acid.
| Compound Name | 2,3-dihydro-1H-inden-2-yl-(4-piperidin-3-ylphenyl)carbamic acid |
|---|---|
| PubChem CID | 67242056 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 2,3-dihydro-1H-inden-2-yl-(4-piperidin-3-ylphenyl)carbamic acid |
| SMILES | O=C(O)N(c1ccc(C2CCCNC2)cc1)C1Cc2ccccc2C1 |
| InChI | InChI=1S/C21H24N2O2/c24-21(25)23(20-12-16-4-1-2-5-17(16)13-20)19-9-7-15(8-10-19)18-6-3-11-22-14-18/h1-2,4-5,7-10,18,20,22H,3,6,11-14H2,(H,24,25) |
| InChIKey | KADUIOQSNQROER-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |