C12H15BrN2O2 — CID 66853257
(4-bromophenyl)-[(3R)-piperidin-3-yl]carbamic acid (PubChem CID 66853257) has the molecular formula C12H15BrN2O2 and a molecular weight of 299.17 g/mol. Its IUPAC name is (4-bromophenyl)-[(3R)-piperidin-3-yl]carbamic acid.
| Compound Name | (4-bromophenyl)-[(3R)-piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 66853257 |
| Molecular Formula | C12H15BrN2O2 |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (4-bromophenyl)-[(3R)-piperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N(c1ccc(Br)cc1)[C@@H]1CCCNC1 |
| InChI | InChI=1S/C12H15BrN2O2/c13-9-3-5-10(6-4-9)15(12(16)17)11-2-1-7-14-8-11/h3-6,11,14H,1-2,7-8H2,(H,16,17)/t11-/m1/s1 |
| InChIKey | KUXSHDGVIAIEFH-LLVKDONJSA-N |
| XLogP | 2.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |