C18H15ClF3NO — CID 67244608
6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole (PubChem CID 67244608) has the molecular formula C18H15ClF3NO and a molecular weight of 353.77 g/mol. Its IUPAC name is 6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole.
| Compound Name | 6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole |
|---|---|
| PubChem CID | 67244608 |
| Molecular Formula | C18H15ClF3NO |
| Molecular Weight | 353.77 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 6-chloro-2,3-dimethyl-1-[[3-(trifluoromethoxy)phenyl]methyl]indole |
| SMILES | Cc1c(C)n(Cc2cccc(OC(F)(F)F)c2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H15ClF3NO/c1-11-12(2)23(17-9-14(19)6-7-16(11)17)10-13-4-3-5-15(8-13)24-18(20,21)22/h3-9H,10H2,1-2H3 |
| InChIKey | NBQZIZHOURUKTP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.77 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|