C17H24ClN3O — CID 67246906
1-methyl-N-[(3S)-3-(methylamino)-4-phenylbutyl]pyrrole-2-carboxamide;hydrochloride (PubChem CID 67246906) has the molecular formula C17H24ClN3O and a molecular weight of 321.85 g/mol. Its IUPAC name is 1-methyl-N-[(3S)-3-(methylamino)-4-phenylbutyl]pyrrole-2-carboxamide;hydrochloride.
| Compound Name | 1-methyl-N-[(3S)-3-(methylamino)-4-phenylbutyl]pyrrole-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 67246906 |
| Molecular Formula | C17H24ClN3O |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-methyl-N-[(3S)-3-(methylamino)-4-phenylbutyl]pyrrole-2-carboxamide;hydrochloride |
| SMILES | CN[C@H](CCNC(=O)c1cccn1C)Cc1ccccc1.Cl |
| InChI | InChI=1S/C17H23N3O.ClH/c1-18-15(13-14-7-4-3-5-8-14)10-11-19-17(21)16-9-6-12-20(16)2;/h3-9,12,15,18H,10-11,13H2,1-2H3,(H,19,21);1H/t15-;/m1./s1 |
| InChIKey | FLQSDVDEGCCUKA-XFULWGLBSA-N |
| XLogP | 2.40 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |