About 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole
1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole (PubChem CID 67252426) has the molecular formula C24H46N2
and a molecular weight of 362.65 g/mol. Its IUPAC name is 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole.
Molecular Properties
| Compound Name | 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole |
| PubChem CID | 67252426 |
| Molecular Formula | C24H46N2 |
| Molecular Weight | 362.65 g/mol |
| Exact Mass | 362.37 |
| IUPAC Name | 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole |
| SMILES | CCCCCCCC/C=C\CCCCCCC(CCC)CN1C=NCC1 |
| InChI | InChI=1S/C24H46N2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-24(18-4-2)22-26-21-20-25-23-26/h11-12,23-24H,3-10,13-22H2,1-2H3/b12-11- |
| InChIKey | KSZISZSIUVBRFW-QXMHVHEDSA-N |
| XLogP | 7.39 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.65 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole?
The IUPAC name of 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole (CID 67252426) is 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole.
What is the SMILES notation for 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole?
The canonical SMILES for 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole is CCCCCCCC/C=C\CCCCCCC(CCC)CN1C=NCC1.
What is the InChIKey of 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole?
The InChIKey is KSZISZSIUVBRFW-QXMHVHEDSA-N. The full InChI is InChI=1S/C24H46N2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-19-24(18-4-2)22-26-21-20-25-23-26/h11-12,23-24H,3-10,13-22H2,1-2H3/b12-11-.
What are the key properties of 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole?
1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole has a molecular weight of 362.65 g/mol, XLogP of 7.39, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-propyloctadec-9-enyl]-4,5-dihydroimidazole is sourced from PubChem (CID 67252426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).