C22H25N3O4 — CID 67253570
amino 1-[(4-methoxyphenyl)methyl]-3-(morpholin-4-ylmethyl)indole-6-carboxylate (PubChem CID 67253570) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is amino 1-[(4-methoxyphenyl)methyl]-3-(morpholin-4-ylmethyl)indole-6-carboxylate.
| Compound Name | amino 1-[(4-methoxyphenyl)methyl]-3-(morpholin-4-ylmethyl)indole-6-carboxylate |
|---|---|
| PubChem CID | 67253570 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | amino 1-[(4-methoxyphenyl)methyl]-3-(morpholin-4-ylmethyl)indole-6-carboxylate |
| SMILES | COc1ccc(Cn2cc(CN3CCOCC3)c3ccc(C(=O)ON)cc32)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-27-19-5-2-16(3-6-19)13-25-15-18(14-24-8-10-28-11-9-24)20-7-4-17(12-21(20)25)22(26)29-23/h2-7,12,15H,8-11,13-14,23H2,1H3 |
| InChIKey | PBLNYRHDZSPNPM-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|