C30H26F2N4O5S — CID 67253704
5-[5-(2,4-difluorophenyl)-2-(1,1-dioxothian-4-yl)-1,3-oxazol-4-yl]-1-[2,6-dimethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]pyridin-2-one (PubChem CID 67253704) has the molecular formula C30H26F2N4O5S and a molecular weight of 592.62 g/mol. Its IUPAC name is 5-[5-(2,4-difluorophenyl)-2-(1,1-dioxothian-4-yl)-1,3-oxazol-4-yl]-1-[2,6-dimethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]pyridin-2-one.
| Compound Name | 5-[5-(2,4-difluorophenyl)-2-(1,1-dioxothian-4-yl)-1,3-oxazol-4-yl]-1-[2,6-dimethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]pyridin-2-one |
|---|---|
| PubChem CID | 67253704 |
| Molecular Formula | C30H26F2N4O5S |
| Molecular Weight | 592.62 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 5-[5-(2,4-difluorophenyl)-2-(1,1-dioxothian-4-yl)-1,3-oxazol-4-yl]-1-[2,6-dimethyl-4-(3-methyl-1,2,4-oxadiazol-5-yl)phenyl]pyridin-2-one |
| SMILES | Cc1noc(-c2cc(C)c(-n3cc(-c4nc(C5CCS(=O)(=O)CC5)oc4-c4ccc(F)cc4F)ccc3=O)c(C)c2)n1 |
| InChI | InChI=1S/C30H26F2N4O5S/c1-16-12-21(30-33-18(3)35-41-30)13-17(2)27(16)36-15-20(4-7-25(36)37)26-28(23-6-5-22(31)14-24(23)32)40-29(34-26)19-8-10-42(38,39)11-9-19/h4-7,12-15,19H,8-11H2,1-3H3 |
| InChIKey | DGYMZTYBYKNLDM-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 121.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |