C7H11F2NO — CID 67253858
4-(2,2-difluoroethyl)-1-methylpyrrolidin-2-one (PubChem CID 67253858) has the molecular formula C7H11F2NO and a molecular weight of 163.17 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-1-methylpyrrolidin-2-one.
| Compound Name | 4-(2,2-difluoroethyl)-1-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 67253858 |
| Molecular Formula | C7H11F2NO |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 4-(2,2-difluoroethyl)-1-methylpyrrolidin-2-one |
| SMILES | CN1CC(CC(F)F)CC1=O |
| InChI | InChI=1S/C7H11F2NO/c1-10-4-5(2-6(8)9)3-7(10)11/h5-6H,2-4H2,1H3 |
| InChIKey | OGVYHIWGVWXZPS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |