C7H8F3NO2 — CID 11095529
1-methyl-3-(2,2,2-trifluoroacetyl)pyrrolidin-2-one (PubChem CID 11095529) has the molecular formula C7H8F3NO2 and a molecular weight of 195.14 g/mol. Its IUPAC name is 1-methyl-3-(2,2,2-trifluoroacetyl)pyrrolidin-2-one.
| Compound Name | 1-methyl-3-(2,2,2-trifluoroacetyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11095529 |
| Molecular Formula | C7H8F3NO2 |
| Molecular Weight | 195.14 g/mol |
| Exact Mass | 195.05 |
| IUPAC Name | 1-methyl-3-(2,2,2-trifluoroacetyl)pyrrolidin-2-one |
| SMILES | CN1CCC(C(=O)C(F)(F)F)C1=O |
| InChI | InChI=1S/C7H8F3NO2/c1-11-3-2-4(6(11)13)5(12)7(8,9)10/h4H,2-3H2,1H3 |
| InChIKey | IJJGBTHCUXMQEU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.14 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|