C8H13F2NO — CID 67255398
4-(2,2-difluoroethyl)-1-ethylpyrrolidin-2-one (PubChem CID 67255398) has the molecular formula C8H13F2NO and a molecular weight of 177.19 g/mol. Its IUPAC name is 4-(2,2-difluoroethyl)-1-ethylpyrrolidin-2-one.
| Compound Name | 4-(2,2-difluoroethyl)-1-ethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 67255398 |
| Molecular Formula | C8H13F2NO |
| Molecular Weight | 177.19 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 4-(2,2-difluoroethyl)-1-ethylpyrrolidin-2-one |
| SMILES | CCN1CC(CC(F)F)CC1=O |
| InChI | InChI=1S/C8H13F2NO/c1-2-11-5-6(3-7(9)10)4-8(11)12/h6-7H,2-5H2,1H3 |
| InChIKey | QACMZLAZJCXIHH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.19 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |