C10H13F8NO — CID 23266384
N,N-diethyl-4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanamide (PubChem CID 23266384) has the molecular formula C10H13F8NO and a molecular weight of 315.20 g/mol. Its IUPAC name is N,N-diethyl-4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanamide.
| Compound Name | N,N-diethyl-4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanamide |
|---|---|
| PubChem CID | 23266384 |
| Molecular Formula | C10H13F8NO |
| Molecular Weight | 315.20 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | N,N-diethyl-4,4,5,5,5-pentafluoro-2-(trifluoromethyl)pentanamide |
| SMILES | CCN(CC)C(=O)C(CC(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H13F8NO/c1-3-19(4-2)7(20)6(9(13,14)15)5-8(11,12)10(16,17)18/h6H,3-5H2,1-2H3 |
| InChIKey | POSSDYMGQOICJB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.20 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|