C12H18NO5P — CID 67254159
[4-nitro-2,3-di(propan-2-yl)phenyl]phosphonic acid (PubChem CID 67254159) has the molecular formula C12H18NO5P and a molecular weight of 287.25 g/mol. Its IUPAC name is [4-nitro-2,3-di(propan-2-yl)phenyl]phosphonic acid.
| Compound Name | [4-nitro-2,3-di(propan-2-yl)phenyl]phosphonic acid |
|---|---|
| PubChem CID | 67254159 |
| Molecular Formula | C12H18NO5P |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | [4-nitro-2,3-di(propan-2-yl)phenyl]phosphonic acid |
| SMILES | CC(C)c1c([N+](=O)[O-])ccc(P(=O)(O)O)c1C(C)C |
| InChI | InChI=1S/C12H18NO5P/c1-7(2)11-9(13(14)15)5-6-10(19(16,17)18)12(11)8(3)4/h5-8H,1-4H3,(H2,16,17,18) |
| InChIKey | GGBJHAADYMVSPU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|