C27H22F4N2O4 — CID 67255925
1-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]-1,3-oxazol-4-yl]pyridin-2-one (PubChem CID 67255925) has the molecular formula C27H22F4N2O4 and a molecular weight of 514.48 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]-1,3-oxazol-4-yl]pyridin-2-one.
| Compound Name | 1-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]-1,3-oxazol-4-yl]pyridin-2-one |
|---|---|
| PubChem CID | 67255925 |
| Molecular Formula | C27H22F4N2O4 |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 1-(2,6-difluorophenyl)-5-[5-(2,4-difluorophenyl)-2-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]-1,3-oxazol-4-yl]pyridin-2-one |
| SMILES | CC1(C)O[C@@H](c2nc(-c3ccc(=O)n(-c4c(F)cccc4F)c3)c(-c3ccc(F)cc3F)o2)C(C)(C)O1 |
| InChI | InChI=1S/C27H22F4N2O4/c1-26(2)24(36-27(3,4)37-26)25-32-21(23(35-25)16-10-9-15(28)12-19(16)31)14-8-11-20(34)33(13-14)22-17(29)6-5-7-18(22)30/h5-13,24H,1-4H3/t24-/m0/s1 |
| InChIKey | AFKVAASVMRUCLL-DEOSSOPVSA-N |
| XLogP | 6.32 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |