C11H18NO3P — CID 67256217
2-(4-amino-3-methoxyphenyl)ethyl-ethylphosphinic acid (PubChem CID 67256217) has the molecular formula C11H18NO3P and a molecular weight of 243.24 g/mol. Its IUPAC name is 2-(4-amino-3-methoxyphenyl)ethyl-ethylphosphinic acid.
| Compound Name | 2-(4-amino-3-methoxyphenyl)ethyl-ethylphosphinic acid |
|---|---|
| PubChem CID | 67256217 |
| Molecular Formula | C11H18NO3P |
| Molecular Weight | 243.24 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-(4-amino-3-methoxyphenyl)ethyl-ethylphosphinic acid |
| SMILES | CCP(=O)(O)CCc1ccc(N)c(OC)c1 |
| InChI | InChI=1S/C11H18NO3P/c1-3-16(13,14)7-6-9-4-5-10(12)11(8-9)15-2/h4-5,8H,3,6-7,12H2,1-2H3,(H,13,14) |
| InChIKey | DWSLBYBWDHAURO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|