About 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine
3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine (PubChem CID 67256389) has the molecular formula C10H8BrN3
and a molecular weight of 250.10 g/mol. Its IUPAC name is 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine |
| PubChem CID | 67256389 |
| Molecular Formula | C10H8BrN3 |
| Molecular Weight | 250.10 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine |
| SMILES | Brc1cc2cc-2c1.Nc1cnccn1 |
| InChI | InChI=1S/C6H3Br.C4H5N3/c7-6-2-4-1-5(4)3-6;5-4-3-6-1-2-7-4/h1-3H;1-3H,(H2,5,7) |
| InChIKey | WPTADJBQFJOWNA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.10 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine?
The IUPAC name of 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine (CID 67256389) is 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine.
What is the SMILES notation for 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine?
The canonical SMILES for 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine is Brc1cc2cc-2c1.Nc1cnccn1.
What is the InChIKey of 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine?
The InChIKey is WPTADJBQFJOWNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Br.C4H5N3/c7-6-2-4-1-5(4)3-6;5-4-3-6-1-2-7-4/h1-3H;1-3H,(H2,5,7).
What are the key properties of 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine?
3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine has a molecular weight of 250.10 g/mol, XLogP of 2.49, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromobicyclo[3.1.0]hexa-1(6),2,4-triene;pyrazin-2-amine is sourced from PubChem (CID 67256389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).