C23H31N5O4 — CID 67263068
tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[6-(prop-2-enylamino)pyrimidin-4-yl]amino]propanoate (PubChem CID 67263068) has the molecular formula C23H31N5O4 and a molecular weight of 441.53 g/mol. Its IUPAC name is tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[6-(prop-2-enylamino)pyrimidin-4-yl]amino]propanoate.
| Compound Name | tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[6-(prop-2-enylamino)pyrimidin-4-yl]amino]propanoate |
|---|---|
| PubChem CID | 67263068 |
| Molecular Formula | C23H31N5O4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[6-(prop-2-enylamino)pyrimidin-4-yl]amino]propanoate |
| SMILES | C=CCNc1cc(N[C@@H](Cc2ccc(OC(=O)N(C)C)cc2)C(=O)OC(C)(C)C)ncn1 |
| InChI | InChI=1S/C23H31N5O4/c1-7-12-24-19-14-20(26-15-25-19)27-18(21(29)32-23(2,3)4)13-16-8-10-17(11-9-16)31-22(30)28(5)6/h7-11,14-15,18H,1,12-13H2,2-6H3,(H2,24,25,26,27)/t18-/m0/s1 |
| InChIKey | RMJHWVOZKZAQKX-SFHVURJKSA-N |
| XLogP | 3.50 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|