C23H30N4O4 — CID 18337302
tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[(5-prop-2-enylpyrimidin-4-yl)amino]propanoate (PubChem CID 18337302) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[(5-prop-2-enylpyrimidin-4-yl)amino]propanoate.
| Compound Name | tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[(5-prop-2-enylpyrimidin-4-yl)amino]propanoate |
|---|---|
| PubChem CID | 18337302 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[(5-prop-2-enylpyrimidin-4-yl)amino]propanoate |
| SMILES | C=CCc1cncnc1N[C@@H](Cc1ccc(OC(=O)N(C)C)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H30N4O4/c1-7-8-17-14-24-15-25-20(17)26-19(21(28)31-23(2,3)4)13-16-9-11-18(12-10-16)30-22(29)27(5)6/h7,9-12,14-15,19H,1,8,13H2,2-6H3,(H,24,25,26)/t19-/m0/s1 |
| InChIKey | KAVNNJQYMJCXIV-IBGZPJMESA-N |
| XLogP | 3.63 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|