C22H21N5O6 — CID 10225908
(2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[5-(3-nitrophenyl)pyrimidin-4-yl]amino]propanoic acid (PubChem CID 10225908) has the molecular formula C22H21N5O6 and a molecular weight of 451.44 g/mol. Its IUPAC name is (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[5-(3-nitrophenyl)pyrimidin-4-yl]amino]propanoic acid.
| Compound Name | (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[5-(3-nitrophenyl)pyrimidin-4-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 10225908 |
| Molecular Formula | C22H21N5O6 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (2S)-3-[4-(dimethylcarbamoyloxy)phenyl]-2-[[5-(3-nitrophenyl)pyrimidin-4-yl]amino]propanoic acid |
| SMILES | CN(C)C(=O)Oc1ccc(C[C@H](Nc2ncncc2-c2cccc([N+](=O)[O-])c2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H21N5O6/c1-26(2)22(30)33-17-8-6-14(7-9-17)10-19(21(28)29)25-20-18(12-23-13-24-20)15-4-3-5-16(11-15)27(31)32/h3-9,11-13,19H,10H2,1-2H3,(H,28,29)(H,23,24,25)/t19-/m0/s1 |
| InChIKey | YFVWNOBDOYWXQX-IBGZPJMESA-N |
| XLogP | 3.22 |
| TPSA | 147.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|