C34H37N5O6 — CID 10438728
(2S)-2-[[2-[cyclohexyl(methyl)amino]-5-(3-nitrophenyl)pyrimidin-4-yl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid (PubChem CID 10438728) has the molecular formula C34H37N5O6 and a molecular weight of 611.70 g/mol. Its IUPAC name is (2S)-2-[[2-[cyclohexyl(methyl)amino]-5-(3-nitrophenyl)pyrimidin-4-yl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[2-[cyclohexyl(methyl)amino]-5-(3-nitrophenyl)pyrimidin-4-yl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 10438728 |
| Molecular Formula | C34H37N5O6 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.27 |
| IUPAC Name | (2S)-2-[[2-[cyclohexyl(methyl)amino]-5-(3-nitrophenyl)pyrimidin-4-yl]amino]-3-[4-(2,6-dimethoxyphenyl)phenyl]propanoic acid |
| SMILES | COc1cccc(OC)c1-c1ccc(C[C@H](Nc2nc(N(C)C3CCCCC3)ncc2-c2cccc([N+](=O)[O-])c2)C(=O)O)cc1 |
| InChI | InChI=1S/C34H37N5O6/c1-38(25-10-5-4-6-11-25)34-35-21-27(24-9-7-12-26(20-24)39(42)43)32(37-34)36-28(33(40)41)19-22-15-17-23(18-16-22)31-29(44-2)13-8-14-30(31)45-3/h7-9,12-18,20-21,25,28H,4-6,10-11,19H2,1-3H3,(H,40,41)(H,35,36,37)/t28-/m0/s1 |
| InChIKey | WNKKOFBWJKRWSO-NDEPHWFRSA-N |
| XLogP | 6.61 |
| TPSA | 139.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|