C29H29N5O5 — CID 23908964
2-[[3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid (PubChem CID 23908964) has the molecular formula C29H29N5O5 and a molecular weight of 527.58 g/mol. Its IUPAC name is 2-[[3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid.
| Compound Name | 2-[[3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 23908964 |
| Molecular Formula | C29H29N5O5 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 2-[[3-(cyclohexylamino)-2-(3-nitrophenyl)imidazo[1,2-a]pyridine-7-carbonyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)C(=O)O)c1ccn2c(NC3CCCCC3)c(-c3cccc([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C29H29N5O5/c35-28(31-24(29(36)37)16-19-8-3-1-4-9-19)21-14-15-33-25(18-21)32-26(20-10-7-13-23(17-20)34(38)39)27(33)30-22-11-5-2-6-12-22/h1,3-4,7-10,13-15,17-18,22,24,30H,2,5-6,11-12,16H2,(H,31,35)(H,36,37) |
| InChIKey | JXJZHAMUALAPGO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|